C24H21N3O14S4 — CID 136613962
7-acetamido-4-hydroxy-3-[[1-sulfo-8-(2-sulfooxyethylsulfonyl)naphthalen-2-yl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136613962) has the molecular formula C24H21N3O14S4 and a molecular weight of 703.71 g/mol. Its IUPAC name is 7-acetamido-4-hydroxy-3-[[1-sulfo-8-(2-sulfooxyethylsulfonyl)naphthalen-2-yl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-acetamido-4-hydroxy-3-[[1-sulfo-8-(2-sulfooxyethylsulfonyl)naphthalen-2-yl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136613962 |
| Molecular Formula | C24H21N3O14S4 |
| Molecular Weight | 703.71 g/mol |
| Exact Mass | 702.99 |
| IUPAC Name | 7-acetamido-4-hydroxy-3-[[1-sulfo-8-(2-sulfooxyethylsulfonyl)naphthalen-2-yl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC(=O)Nc1ccc2c(O)c(/N=N/c3ccc4cccc(S(=O)(=O)CCOS(=O)(=O)O)c4c3S(=O)(=O)O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C24H21N3O14S4/c1-13(28)25-16-6-7-17-15(11-16)12-20(43(32,33)34)22(23(17)29)27-26-18-8-5-14-3-2-4-19(21(14)24(18)44(35,36)37)42(30,31)10-9-41-45(38,39)40/h2-8,11-12,29H,9-10H2,1H3,(H,25,28)(H,32,33,34)(H,35,36,37)(H,38,39,40)/b27-26+ |
| InChIKey | WGRKMOOHERLUHF-CYYJNZCTSA-N |
| XLogP | 3.16 |
| TPSA | 280.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|