C23H14Cl2N6O10S3 — CID 135466409
2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 135466409) has the molecular formula C23H14Cl2N6O10S3 and a molecular weight of 701.50 g/mol. Its IUPAC name is 2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 135466409 |
| Molecular Formula | C23H14Cl2N6O10S3 |
| Molecular Weight | 701.50 g/mol |
| Exact Mass | 699.93 |
| IUPAC Name | 2-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(Nc3nc(Cl)nc(Cl)n3)ccc2c(O)c1/N=N/c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C23H14Cl2N6O10S3/c24-21-27-22(25)29-23(28-21)26-11-4-5-12-10(8-11)9-17(43(36,37)38)18(19(12)32)31-30-15-7-6-13-14(20(15)44(39,40)41)2-1-3-16(13)42(33,34)35/h1-9,32H,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,26,27,28,29)/b31-30+ |
| InChIKey | SNBKMJRQHBEAFI-NVQSTNCTSA-N |
| XLogP | 5.09 |
| TPSA | 258.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|