C28H24ClN7O14S4 — CID 136914879
7-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136914879) has the molecular formula C28H24ClN7O14S4 and a molecular weight of 846.26 g/mol. Its IUPAC name is 7-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136914879 |
| Molecular Formula | C28H24ClN7O14S4 |
| Molecular Weight | 846.26 g/mol |
| Exact Mass | 845.00 |
| IUPAC Name | 7-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4nc(Cl)nc(Nc5cccc(S(=O)(=O)CCOS(=O)(=O)O)c5)n4)ccc3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H24ClN7O14S4/c1-49-18-6-8-21(22(14-18)52(40,41)42)35-36-24-23(53(43,44)45)12-15-11-17(5-7-20(15)25(24)37)31-28-33-26(29)32-27(34-28)30-16-3-2-4-19(13-16)51(38,39)10-9-50-54(46,47)48/h2-8,11-14,37H,9-10H2,1H3,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | FJWYCDGEGLMHBC-ULDVOPSXSA-N |
| XLogP | 4.38 |
| TPSA | 323.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|