C27H23ClN8O15S5 — CID 23399330
3-amino-4-[[5-[[4-chloro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 23399330) has the molecular formula C27H23ClN8O15S5 and a molecular weight of 895.31 g/mol. Its IUPAC name is 3-amino-4-[[5-[[4-chloro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 3-amino-4-[[5-[[4-chloro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 23399330 |
| Molecular Formula | C27H23ClN8O15S5 |
| Molecular Weight | 895.31 g/mol |
| Exact Mass | 893.96 |
| IUPAC Name | 3-amino-4-[[5-[[4-chloro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc2c1/N=N/c1cc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C27H23ClN8O15S5/c28-25-32-26(30-15-1-4-17(5-2-15)52(37,38)10-9-51-56(48,49)50)34-27(33-25)31-16-3-8-21(54(42,43)44)20(13-16)35-36-24-19-7-6-18(53(39,40)41)11-14(19)12-22(23(24)29)55(45,46)47/h1-8,11-13H,9-10,29H2,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | YEHWTMLWPWRYQS-ULDVOPSXSA-N |
| XLogP | 3.50 |
| TPSA | 374.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|