C33H29N9O15S5 — CID 23399267
1-amino-4-[[2-sulfo-5-[[4-(3-sulfoanilino)-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 23399267) has the molecular formula C33H29N9O15S5 and a molecular weight of 951.98 g/mol. Its IUPAC name is 1-amino-4-[[2-sulfo-5-[[4-(3-sulfoanilino)-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 1-amino-4-[[2-sulfo-5-[[4-(3-sulfoanilino)-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 23399267 |
| Molecular Formula | C33H29N9O15S5 |
| Molecular Weight | 951.98 g/mol |
| Exact Mass | 951.04 |
| IUPAC Name | 1-amino-4-[[2-sulfo-5-[[4-(3-sulfoanilino)-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(/N=N/c2cc(Nc3nc(Nc4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)nc(Nc4cccc(S(=O)(=O)O)c4)n3)ccc2S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C33H29N9O15S5/c34-30-25-7-2-1-6-24(25)26(18-29(30)61(51,52)53)41-42-27-17-21(10-13-28(27)60(48,49)50)37-33-39-31(38-32(40-33)36-20-4-3-5-23(16-20)59(45,46)47)35-19-8-11-22(12-9-19)58(43,44)15-14-57-62(54,55)56/h1-13,16-18H,14-15,34H2,(H,45,46,47)(H,48,49,50)(H,51,52,53)(H,54,55,56)(H3,35,36,37,38,39,40)/b42-41+ |
| InChIKey | IRKUDTMRSNJFCF-WQVHNPAPSA-N |
| XLogP | 4.59 |
| TPSA | 386.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|