C24H22N10O12S4 — CID 165363216
2-amino-4-[[4-(cyanoamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 165363216) has the molecular formula C24H22N10O12S4 and a molecular weight of 770.77 g/mol. Its IUPAC name is 2-amino-4-[[4-(cyanoamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-(cyanoamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 165363216 |
| Molecular Formula | C24H22N10O12S4 |
| Molecular Weight | 770.77 g/mol |
| Exact Mass | 770.03 |
| IUPAC Name | 2-amino-4-[[4-(cyanoamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | N#CNc1nc(Nc2ccc(S(=O)(=O)O)cc2)nc(Nc2cc(N)c(S(=O)(=O)O)cc2/N=N/c2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C24H22N10O12S4/c25-13-27-22-30-23(28-14-4-6-16(7-5-14)48(37,38)39)32-24(31-22)29-19-11-18(26)21(49(40,41)42)12-20(19)34-33-15-2-1-3-17(10-15)47(35,36)9-8-46-50(43,44)45/h1-7,10-12H,8-9,26H2,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H3,27,28,29,30,31,32)/b34-33+ |
| InChIKey | VCYGVDWVCMEEAH-JEIPZWNWSA-N |
| XLogP | 2.34 |
| TPSA | 355.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|