C20H19N3O9S3 — CID 20571632
2-[(4-anilinophenyl)diazenyl]-4-(2-sulfooxyethylsulfonyl)benzenesulfonic acid (PubChem CID 20571632) has the molecular formula C20H19N3O9S3 and a molecular weight of 541.59 g/mol. Its IUPAC name is 2-[(4-anilinophenyl)diazenyl]-4-(2-sulfooxyethylsulfonyl)benzenesulfonic acid.
| Compound Name | 2-[(4-anilinophenyl)diazenyl]-4-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 20571632 |
| Molecular Formula | C20H19N3O9S3 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 2-[(4-anilinophenyl)diazenyl]-4-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(S(=O)(=O)O)c(/N=N/c2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C20H19N3O9S3/c24-33(25,13-12-32-35(29,30)31)18-10-11-20(34(26,27)28)19(14-18)23-22-17-8-6-16(7-9-17)21-15-4-2-1-3-5-15/h1-11,14,21H,12-13H2,(H,26,27,28)(H,29,30,31)/b23-22+ |
| InChIKey | IBSJOTCDRAHLRF-GHVJWSGMSA-N |
| XLogP | 3.69 |
| TPSA | 188.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|