C17H19N3O8S2 — CID 21429677
2-[[4-(dimethylamino)phenyl]diazenyl]-4-(2-sulfooxyethylsulfonyl)benzoic acid (PubChem CID 21429677) has the molecular formula C17H19N3O8S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]diazenyl]-4-(2-sulfooxyethylsulfonyl)benzoic acid.
| Compound Name | 2-[[4-(dimethylamino)phenyl]diazenyl]-4-(2-sulfooxyethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 21429677 |
| Molecular Formula | C17H19N3O8S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]diazenyl]-4-(2-sulfooxyethylsulfonyl)benzoic acid |
| SMILES | CN(C)c1ccc(/N=N/c2cc(S(=O)(=O)CCOS(=O)(=O)O)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H19N3O8S2/c1-20(2)13-5-3-12(4-6-13)18-19-16-11-14(7-8-15(16)17(21)22)29(23,24)10-9-28-30(25,26)27/h3-8,11H,9-10H2,1-2H3,(H,21,22)(H,25,26,27)/b19-18+ |
| InChIKey | KUSBSMYYKHAMEF-VHEBQXMUSA-N |
| XLogP | 2.46 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|