C19H21N3O4S — CID 19020072
2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylethyl prop-2-enoate (PubChem CID 19020072) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylethyl prop-2-enoate.
| Compound Name | 2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylethyl prop-2-enoate |
|---|---|
| PubChem CID | 19020072 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCS(=O)(=O)c1ccc(/N=N/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-4-19(23)26-13-14-27(24,25)18-11-7-16(8-12-18)21-20-15-5-9-17(10-6-15)22(2)3/h4-12H,1,13-14H2,2-3H3/b21-20+ |
| InChIKey | RYRDTNJNRYNGEY-QZQOTICOSA-N |
| XLogP | 3.67 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|