C13H16O5S — CID 19745504
4-(4-hydroxyphenyl)sulfonylbutyl prop-2-enoate (PubChem CID 19745504) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)sulfonylbutyl prop-2-enoate.
| Compound Name | 4-(4-hydroxyphenyl)sulfonylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 19745504 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-(4-hydroxyphenyl)sulfonylbutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O5S/c1-2-13(15)18-9-3-4-10-19(16,17)12-7-5-11(14)6-8-12/h2,5-8,14H,1,3-4,9-10H2 |
| InChIKey | ROFQNHHAMZUHTA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|