C24H28O5S — CID 54239095
6-[4-[2-(4-methoxyphenyl)ethenyl]phenyl]sulfonylhexyl prop-2-enoate (PubChem CID 54239095) has the molecular formula C24H28O5S and a molecular weight of 428.55 g/mol. Its IUPAC name is 6-[4-[2-(4-methoxyphenyl)ethenyl]phenyl]sulfonylhexyl prop-2-enoate.
| Compound Name | 6-[4-[2-(4-methoxyphenyl)ethenyl]phenyl]sulfonylhexyl prop-2-enoate |
|---|---|
| PubChem CID | 54239095 |
| Molecular Formula | C24H28O5S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 6-[4-[2-(4-methoxyphenyl)ethenyl]phenyl]sulfonylhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCS(=O)(=O)c1ccc(C=Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H28O5S/c1-3-24(25)29-18-6-4-5-7-19-30(26,27)23-16-12-21(13-17-23)9-8-20-10-14-22(28-2)15-11-20/h3,8-17H,1,4-7,18-19H2,2H3 |
| InChIKey | QOSOPKOODBIHSG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|