C31H32O6 — CID 101360108
[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 101360108) has the molecular formula C31H32O6 and a molecular weight of 500.59 g/mol. Its IUPAC name is [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 101360108 |
| Molecular Formula | C31H32O6 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(OC(=O)/C=C/c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H32O6/c1-3-30(32)36-23-7-5-4-6-22-35-28-17-11-25(12-18-28)26-13-19-29(20-14-26)37-31(33)21-10-24-8-15-27(34-2)16-9-24/h3,8-21H,1,4-7,22-23H2,2H3/b21-10+ |
| InChIKey | QHACJUVRLFOISS-UFFVCSGVSA-N |
| XLogP | 6.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|