C31H46O6S — CID 59281735
[4-(6-prop-2-enoyloxyhexylsulfonyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 59281735) has the molecular formula C31H46O6S and a molecular weight of 546.77 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexylsulfonyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(6-prop-2-enoyloxyhexylsulfonyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59281735 |
| Molecular Formula | C31H46O6S |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexylsulfonyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCS(=O)(=O)c1ccc(OC(=O)C2CCC(C3CCC(CCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H46O6S/c1-3-9-24-10-12-25(13-11-24)26-14-16-27(17-15-26)31(33)37-28-18-20-29(21-19-28)38(34,35)23-8-6-5-7-22-36-30(32)4-2/h4,18-21,24-27H,2-3,5-17,22-23H2,1H3 |
| InChIKey | FDZIECMJWOLKNN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|