C56H78O12S2 — CID 159087695
bis(4-prop-2-enoyloxybutyl) 2-[4,7-bis[[4-(4-propylcyclohexyl)cyclohexanecarbonyl]oxy]-1,3-benzodithiol-2-ylidene]propanedioate (PubChem CID 159087695) has the molecular formula C56H78O12S2 and a molecular weight of 1007.36 g/mol. Its IUPAC name is bis(4-prop-2-enoyloxybutyl) 2-[4,7-bis[[4-(4-propylcyclohexyl)cyclohexanecarbonyl]oxy]-1,3-benzodithiol-2-ylidene]propanedioate.
| Compound Name | bis(4-prop-2-enoyloxybutyl) 2-[4,7-bis[[4-(4-propylcyclohexyl)cyclohexanecarbonyl]oxy]-1,3-benzodithiol-2-ylidene]propanedioate |
|---|---|
| PubChem CID | 159087695 |
| Molecular Formula | C56H78O12S2 |
| Molecular Weight | 1007.36 g/mol |
| Exact Mass | 1006.49 |
| IUPAC Name | bis(4-prop-2-enoyloxybutyl) 2-[4,7-bis[[4-(4-propylcyclohexyl)cyclohexanecarbonyl]oxy]-1,3-benzodithiol-2-ylidene]propanedioate |
| SMILES | C=CC(=O)OCCCCOC(=O)C(C(=O)OCCCCOC(=O)C=C)=C1Sc2c(OC(=O)C3CCC(C4CCC(CCC)CC4)CC3)ccc(OC(=O)C3CCC(C4CCC(CCC)CC4)CC3)c2S1 |
| InChI | InChI=1S/C56H78O12S2/c1-5-13-37-15-19-39(20-16-37)41-23-27-43(28-24-41)52(59)67-45-31-32-46(68-53(60)44-29-25-42(26-30-44)40-21-17-38(14-6-2)18-22-40)51-50(45)69-56(70-51)49(54(61)65-35-11-9-33-63-47(57)7-3)55(62)66-36-12-10-34-64-48(58)8-4/h7-8,31-32,37-44H,3-6,9-30,33-36H2,1-2H3 |
| InChIKey | KBQPLWCMXSHPOA-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.36 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|