C15H20O5S — CID 19745480
3-(4-hydroxy-3-propan-2-ylphenyl)sulfonylpropyl prop-2-enoate (PubChem CID 19745480) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-(4-hydroxy-3-propan-2-ylphenyl)sulfonylpropyl prop-2-enoate.
| Compound Name | 3-(4-hydroxy-3-propan-2-ylphenyl)sulfonylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 19745480 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(4-hydroxy-3-propan-2-ylphenyl)sulfonylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCS(=O)(=O)c1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C15H20O5S/c1-4-15(17)20-8-5-9-21(18,19)12-6-7-14(16)13(10-12)11(2)3/h4,6-7,10-11,16H,1,5,8-9H2,2-3H3 |
| InChIKey | QQQUIGASXUOTQB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|