C13H19NO5S — CID 89405907
4-methylbenzenesulfonate;3-prop-2-enoyloxypropylazanium (PubChem CID 89405907) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-prop-2-enoyloxypropylazanium.
| Compound Name | 4-methylbenzenesulfonate;3-prop-2-enoyloxypropylazanium |
|---|---|
| PubChem CID | 89405907 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-methylbenzenesulfonate;3-prop-2-enoyloxypropylazanium |
| SMILES | C=CC(=O)OCCC[NH3+].Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C6H11NO2/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-6(8)9-5-3-4-7/h2-5H,1H3,(H,8,9,10);2H,1,3-5,7H2 |
| InChIKey | LUMUWVRJCONMSF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|