C24H41O5PS — CID 139768695
2-[tributyl-(4-methylphenyl)sulfonyloxy-λ5-phosphanyl]ethyl prop-2-enoate (PubChem CID 139768695) has the molecular formula C24H41O5PS and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[tributyl-(4-methylphenyl)sulfonyloxy-λ5-phosphanyl]ethyl prop-2-enoate.
| Compound Name | 2-[tributyl-(4-methylphenyl)sulfonyloxy-λ5-phosphanyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 139768695 |
| Molecular Formula | C24H41O5PS |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[tributyl-(4-methylphenyl)sulfonyloxy-λ5-phosphanyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCP(CCCC)(CCCC)(CCCC)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H41O5PS/c1-6-10-18-30(19-11-7-2,20-12-8-3,21-17-28-24(25)9-4)29-31(26,27)23-15-13-22(5)14-16-23/h9,13-16H,4,6-8,10-12,17-21H2,1-3,5H3 |
| InChIKey | MLZDEKVCBCWZCB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|