C32H49O8PS — CID 87720495
dimethyl 5-[4-(tetrabutyl-λ5-phosphanyl)oxysulfonylphenoxy]benzene-1,3-dicarboxylate (PubChem CID 87720495) has the molecular formula C32H49O8PS and a molecular weight of 624.78 g/mol. Its IUPAC name is dimethyl 5-[4-(tetrabutyl-λ5-phosphanyl)oxysulfonylphenoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[4-(tetrabutyl-λ5-phosphanyl)oxysulfonylphenoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 87720495 |
| Molecular Formula | C32H49O8PS |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | dimethyl 5-[4-(tetrabutyl-λ5-phosphanyl)oxysulfonylphenoxy]benzene-1,3-dicarboxylate |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)OS(=O)(=O)c1ccc(Oc2cc(C(=O)OC)cc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C32H49O8PS/c1-7-11-19-41(20-12-8-2,21-13-9-3,22-14-10-4)40-42(35,36)30-17-15-28(16-18-30)39-29-24-26(31(33)37-5)23-27(25-29)32(34)38-6/h15-18,23-25H,7-14,19-22H2,1-6H3 |
| InChIKey | NRTBARYNROYJBG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|