C18H20O6S — CID 59649315
methyl 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxybenzoate (PubChem CID 59649315) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxybenzoate.
| Compound Name | methyl 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 59649315 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | methyl 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(OC(C)C)c1 |
| InChI | InChI=1S/C18H20O6S/c1-12(2)23-15-9-13(18(19)22-3)10-16(11-15)24-14-5-7-17(8-6-14)25(4,20)21/h5-12H,1-4H3 |
| InChIKey | YIRNFTJYDSWBTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |