C17H18O7S — CID 59404949
3-[(2S)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid (PubChem CID 59404949) has the molecular formula C17H18O7S and a molecular weight of 366.39 g/mol. Its IUPAC name is 3-[(2S)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid.
| Compound Name | 3-[(2S)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid |
|---|---|
| PubChem CID | 59404949 |
| Molecular Formula | C17H18O7S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-[(2S)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid |
| SMILES | C[C@@H](CO)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H18O7S/c1-11(10-18)23-14-7-12(17(19)20)8-15(9-14)24-13-3-5-16(6-4-13)25(2,21)22/h3-9,11,18H,10H2,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | MEPFPGNXRBVYBF-NSHDSACASA-N |
| XLogP | 2.34 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |