C14H12O6S — CID 23093006
3-hydroxy-5-(4-methylsulfonylphenoxy)benzoic acid (PubChem CID 23093006) has the molecular formula C14H12O6S and a molecular weight of 308.31 g/mol. Its IUPAC name is 3-hydroxy-5-(4-methylsulfonylphenoxy)benzoic acid.
| Compound Name | 3-hydroxy-5-(4-methylsulfonylphenoxy)benzoic acid |
|---|---|
| PubChem CID | 23093006 |
| Molecular Formula | C14H12O6S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-hydroxy-5-(4-methylsulfonylphenoxy)benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C14H12O6S/c1-21(18,19)13-4-2-11(3-5-13)20-12-7-9(14(16)17)6-10(15)8-12/h2-8,15H,1H3,(H,16,17) |
| InChIKey | ZQRYATMDRSDNNA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |