C18H16O7S — CID 66755913
2-(methoxymethyl)-4-(4-methylsulfonylphenoxy)-1-benzofuran-6-carboxylic acid (PubChem CID 66755913) has the molecular formula C18H16O7S and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-(4-methylsulfonylphenoxy)-1-benzofuran-6-carboxylic acid.
| Compound Name | 2-(methoxymethyl)-4-(4-methylsulfonylphenoxy)-1-benzofuran-6-carboxylic acid |
|---|---|
| PubChem CID | 66755913 |
| Molecular Formula | C18H16O7S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(methoxymethyl)-4-(4-methylsulfonylphenoxy)-1-benzofuran-6-carboxylic acid |
| SMILES | COCc1cc2c(Oc3ccc(S(C)(=O)=O)cc3)cc(C(=O)O)cc2o1 |
| InChI | InChI=1S/C18H16O7S/c1-23-10-13-9-15-16(7-11(18(19)20)8-17(15)25-13)24-12-3-5-14(6-4-12)26(2,21)22/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | FKVMIKRLVDEWSV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |