C18H16O6S — CID 162056840
2-ethyl-4-(4-methylphenoxy)-1-benzofuran-6-carboxylic acid;sulfur dioxide (PubChem CID 162056840) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-ethyl-4-(4-methylphenoxy)-1-benzofuran-6-carboxylic acid;sulfur dioxide.
| Compound Name | 2-ethyl-4-(4-methylphenoxy)-1-benzofuran-6-carboxylic acid;sulfur dioxide |
|---|---|
| PubChem CID | 162056840 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-ethyl-4-(4-methylphenoxy)-1-benzofuran-6-carboxylic acid;sulfur dioxide |
| SMILES | CCc1cc2c(Oc3ccc(C)cc3)cc(C(=O)O)cc2o1.O=S=O |
| InChI | InChI=1S/C18H16O4.O2S/c1-3-13-10-15-16(21-13)8-12(18(19)20)9-17(15)22-14-6-4-11(2)5-7-14;1-3-2/h4-10H,3H2,1-2H3,(H,19,20); |
| InChIKey | YZHLAHHMUOAWEN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |