About 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid
3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid (PubChem CID 142698612) has the molecular formula C19H22O5
and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid |
| PubChem CID | 142698612 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid |
| SMILES | CCCCc1ccc(Oc2cc(C(=O)O)cc(OC)c2OC)cc1 |
| InChI | InChI=1S/C19H22O5/c1-4-5-6-13-7-9-15(10-8-13)24-17-12-14(19(20)21)11-16(22-2)18(17)23-3/h7-12H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | HYVCKAPMPNJQGZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid?
The IUPAC name of 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid (CID 142698612) is 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid?
The canonical SMILES for 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid is CCCCc1ccc(Oc2cc(C(=O)O)cc(OC)c2OC)cc1.
What is the InChIKey of 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid?
The InChIKey is HYVCKAPMPNJQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O5/c1-4-5-6-13-7-9-15(10-8-13)24-17-12-14(19(20)21)11-16(22-2)18(17)23-3/h7-12H,4-6H2,1-3H3,(H,20,21).
What are the key properties of 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid?
3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid has a molecular weight of 330.38 g/mol, XLogP of 4.54, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butylphenoxy)-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 142698612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).