C15H14O6S — CID 59649435
3-methoxy-5-(4-methylsulfonylphenoxy)benzoic acid (PubChem CID 59649435) has the molecular formula C15H14O6S and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-methoxy-5-(4-methylsulfonylphenoxy)benzoic acid.
| Compound Name | 3-methoxy-5-(4-methylsulfonylphenoxy)benzoic acid |
|---|---|
| PubChem CID | 59649435 |
| Molecular Formula | C15H14O6S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-methoxy-5-(4-methylsulfonylphenoxy)benzoic acid |
| SMILES | COc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H14O6S/c1-20-12-7-10(15(16)17)8-13(9-12)21-11-3-5-14(6-4-11)22(2,18)19/h3-9H,1-2H3,(H,16,17) |
| InChIKey | KYTCTJHDRBJDLI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |