C19H21NO4S — CID 123536465
[3-methyl-5-(4-methylsulfonylphenoxy)phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 123536465) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is [3-methyl-5-(4-methylsulfonylphenoxy)phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-methyl-5-(4-methylsulfonylphenoxy)phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 123536465 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [3-methyl-5-(4-methylsulfonylphenoxy)phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H21NO4S/c1-14-11-15(19(21)20-9-3-4-10-20)13-17(12-14)24-16-5-7-18(8-6-16)25(2,22)23/h5-8,11-13H,3-4,9-10H2,1-2H3 |
| InChIKey | GSNGDAAOJGLTOA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |