C25H26N2O4S — CID 17491479
[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-(4-phenoxyphenyl)methanone (PubChem CID 17491479) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is [4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-(4-phenoxyphenyl)methanone.
| Compound Name | [4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 17491479 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-(4-phenoxyphenyl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C(=O)c3ccc(Oc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-20-8-14-24(15-9-20)32(29,30)27-17-5-16-26(18-19-27)25(28)21-10-12-23(13-11-21)31-22-6-3-2-4-7-22/h2-4,6-15H,5,16-19H2,1H3 |
| InChIKey | QGIYKNFZOCYQQZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |