C22H24N2O4S — CID 33183639
2H-chromen-3-yl-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methanone (PubChem CID 33183639) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2H-chromen-3-yl-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methanone.
| Compound Name | 2H-chromen-3-yl-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 33183639 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2H-chromen-3-yl-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C(=O)C3=Cc4ccccc4OC3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-17-7-9-20(10-8-17)29(26,27)24-12-4-11-23(13-14-24)22(25)19-15-18-5-2-3-6-21(18)28-16-19/h2-3,5-10,15H,4,11-14,16H2,1H3 |
| InChIKey | GXVLGPZSGHRTJZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |