C17H21NO5S — CID 59627783
3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)aniline (PubChem CID 59627783) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)aniline.
| Compound Name | 3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)aniline |
|---|---|
| PubChem CID | 59627783 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)aniline |
| SMILES | COC[C@H](C)Oc1cc(N)cc(Oc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C17H21NO5S/c1-12(11-21-2)22-15-8-13(18)9-16(10-15)23-14-4-6-17(7-5-14)24(3,19)20/h4-10,12H,11,18H2,1-3H3/t12-/m0/s1 |
| InChIKey | GBNGFEXKUDDUMV-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|