C25H30N2O7S — CID 66682539
N-(3-hydroxypropyl)-5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 66682539) has the molecular formula C25H30N2O7S and a molecular weight of 502.59 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66682539 |
| Molecular Formula | C25H30N2O7S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-(3-hydroxypropyl)-5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | COC[C@H](C)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(-c2ccc(C(=O)NCCCO)[nH]2)c1 |
| InChI | InChI=1S/C25H30N2O7S/c1-17(16-32-2)33-20-13-18(23-9-10-24(27-23)25(29)26-11-4-12-28)14-21(15-20)34-19-5-7-22(8-6-19)35(3,30)31/h5-10,13-15,17,27-28H,4,11-12,16H2,1-3H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | MPBJUIMIDRLQJE-KRWDZBQOSA-N |
| XLogP | 3.40 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|