C30H29O7PS — CID 14548452
dimethyl 5-[methyl-(4-methylphenyl)sulfonyloxy-diphenyl-lambda5-phosphanyl]benzene-1,3-dicarboxylate (PubChem CID 14548452) has the molecular formula C30H29O7PS and a molecular weight of 564.60 g/mol. Its IUPAC name is dimethyl 5-[methyl-(4-methylphenyl)sulfonyloxy-diphenyl-lambda5-phosphanyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[methyl-(4-methylphenyl)sulfonyloxy-diphenyl-lambda5-phosphanyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 14548452 |
| Molecular Formula | C30H29O7PS |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | dimethyl 5-[methyl-(4-methylphenyl)sulfonyloxy-diphenyl-lambda5-phosphanyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(P(C)(OS(=O)(=O)c2ccc(C)cc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H29O7PS/c1-22-15-17-28(18-16-22)39(33,34)37-38(4,25-11-7-5-8-12-25,26-13-9-6-10-14-26)27-20-23(29(31)35-2)19-24(21-27)30(32)36-3/h5-21H,1-4H3 |
| InChIKey | UBXXFHLNQHCXGI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|