About [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate
[dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate (PubChem CID 71368115) has the molecular formula C21H23O3PS
and a molecular weight of 386.45 g/mol. Its IUPAC name is [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate |
| PubChem CID | 71368115 |
| Molecular Formula | C21H23O3PS |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OP(C)(C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23O3PS/c1-18-14-16-21(17-15-18)26(22,23)24-25(2,3,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17H,1-3H3 |
| InChIKey | KXJNWEBPRZRZAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate?
The IUPAC name of [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate (CID 71368115) is [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OP(C)(C)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate?
The InChIKey is KXJNWEBPRZRZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23O3PS/c1-18-14-16-21(17-15-18)26(22,23)24-25(2,3,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17H,1-3H3.
What are the key properties of [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate?
[dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate has a molecular weight of 386.45 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(diphenyl)-λ5-phosphanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 71368115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).