C28H27O5PS — CID 12066018
methyl 2-[(4-methylphenyl)sulfonyloxy-triphenyl-λ5-phosphanyl]acetate (PubChem CID 12066018) has the molecular formula C28H27O5PS and a molecular weight of 506.56 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfonyloxy-triphenyl-λ5-phosphanyl]acetate.
| Compound Name | methyl 2-[(4-methylphenyl)sulfonyloxy-triphenyl-λ5-phosphanyl]acetate |
|---|---|
| PubChem CID | 12066018 |
| Molecular Formula | C28H27O5PS |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfonyloxy-triphenyl-λ5-phosphanyl]acetate |
| SMILES | COC(=O)CP(OS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H27O5PS/c1-23-18-20-27(21-19-23)35(30,31)33-34(22-28(29)32-2,24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21H,22H2,1-2H3 |
| InChIKey | ZBCNJDMKLINIFM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|