About methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate
methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate (PubChem CID 12066016) has the molecular formula C23H22ClO4P
and a molecular weight of 428.85 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate |
| PubChem CID | 12066016 |
| Molecular Formula | C23H22ClO4P |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate |
| SMILES | COC(=O)CP(OC(=O)CCl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClO4P/c1-27-23(26)18-29(28-22(25)17-24,19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16H,17-18H2,1H3 |
| InChIKey | UEAANFKZRDAKCQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate?
The IUPAC name of methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate (CID 12066016) is methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate.
What is the SMILES notation for methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate?
The canonical SMILES for methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate is COC(=O)CP(OC(=O)CCl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate?
The InChIKey is UEAANFKZRDAKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClO4P/c1-27-23(26)18-29(28-22(25)17-24,19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16H,17-18H2,1H3.
What are the key properties of methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate?
methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate has a molecular weight of 428.85 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-chloroacetyl)oxy-triphenyl-λ5-phosphanyl]acetate is sourced from PubChem (CID 12066016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).