About methyl 2-anilinooxyacetate
methyl 2-anilinooxyacetate (PubChem CID 154072974) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 2-anilinooxyacetate.
Molecular Properties
| Compound Name | methyl 2-anilinooxyacetate |
| PubChem CID | 154072974 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | methyl 2-anilinooxyacetate |
| SMILES | COC(=O)CONc1ccccc1 |
| InChI | InChI=1S/C9H11NO3/c1-12-9(11)7-13-10-8-5-3-2-4-6-8/h2-6,10H,7H2,1H3 |
| InChIKey | IBIWFVJPBOITIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-anilinooxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-anilinooxyacetate?
The IUPAC name of methyl 2-anilinooxyacetate (CID 154072974) is methyl 2-anilinooxyacetate.
What is the SMILES notation for methyl 2-anilinooxyacetate?
The canonical SMILES for methyl 2-anilinooxyacetate is COC(=O)CONc1ccccc1.
What is the InChIKey of methyl 2-anilinooxyacetate?
The InChIKey is IBIWFVJPBOITIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-12-9(11)7-13-10-8-5-3-2-4-6-8/h2-6,10H,7H2,1H3.
What are the key properties of methyl 2-anilinooxyacetate?
methyl 2-anilinooxyacetate has a molecular weight of 181.19 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-anilinooxyacetate is sourced from PubChem (CID 154072974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).