About methyl (3R)-3-anilinobutanoate
methyl (3R)-3-anilinobutanoate (PubChem CID 11333008) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl (3R)-3-anilinobutanoate.
Molecular Properties
| Compound Name | methyl (3R)-3-anilinobutanoate |
| PubChem CID | 11333008 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl (3R)-3-anilinobutanoate |
| SMILES | COC(=O)C[C@@H](C)Nc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-9(8-11(13)14-2)12-10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | IEYGIYJFTCKIOC-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3R)-3-anilinobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-3-anilinobutanoate?
The IUPAC name of methyl (3R)-3-anilinobutanoate (CID 11333008) is methyl (3R)-3-anilinobutanoate.
What is the SMILES notation for methyl (3R)-3-anilinobutanoate?
The canonical SMILES for methyl (3R)-3-anilinobutanoate is COC(=O)C[C@@H](C)Nc1ccccc1.
What is the InChIKey of methyl (3R)-3-anilinobutanoate?
The InChIKey is IEYGIYJFTCKIOC-SECBINFHSA-N. The full InChI is InChI=1S/C11H15NO2/c1-9(8-11(13)14-2)12-10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3/t9-/m1/s1.
What are the key properties of methyl (3R)-3-anilinobutanoate?
methyl (3R)-3-anilinobutanoate has a molecular weight of 193.25 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-anilinobutanoate is sourced from PubChem (CID 11333008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).