About 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate
1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate (PubChem CID 56997215) has the molecular formula C14H18N2O5
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate |
| PubChem CID | 56997215 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate |
| SMILES | COC(=O)C[C@H](N)C(=O)OC(=O)[C@H](C)Nc1ccccc1 |
| InChI | InChI=1S/C14H18N2O5/c1-9(16-10-6-4-3-5-7-10)13(18)21-14(19)11(15)8-12(17)20-2/h3-7,9,11,16H,8,15H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | WMWJPUVYYSLGOL-ONGXEEELSA-N |
| XLogP | 0.45 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate?
The IUPAC name of 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate (CID 56997215) is 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate.
What is the SMILES notation for 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate?
The canonical SMILES for 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate is COC(=O)C[C@H](N)C(=O)OC(=O)[C@H](C)Nc1ccccc1.
What is the InChIKey of 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate?
The InChIKey is WMWJPUVYYSLGOL-ONGXEEELSA-N. The full InChI is InChI=1S/C14H18N2O5/c1-9(16-10-6-4-3-5-7-10)13(18)21-14(19)11(15)8-12(17)20-2/h3-7,9,11,16H,8,15H2,1-2H3/t9-,11-/m0/s1.
What are the key properties of 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate?
1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate has a molecular weight of 294.31 g/mol, XLogP of 0.45, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(2S)-2-anilinopropanoyl] 4-O-methyl (2S)-2-aminobutanedioate is sourced from PubChem (CID 56997215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).