methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate

C21H21O3P — CID 140553045

IUPACmethyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate
SMILESCOC(=O)CP(O)(c1ccccc1)(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H21O3P/c1-24-21(22)17-25(23,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23H,17H2,1H3
InChIKeySPTNHCXJEBXECR-UHFFFAOYSA-N
MW352.37 g/mol
LogP2.60
Rot. Bonds5

About methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate

methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate (PubChem CID 140553045) has the molecular formula C21H21O3P and a molecular weight of 352.37 g/mol. Its IUPAC name is methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate.

Molecular Properties

Compound Namemethyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate
PubChem CID140553045
Molecular FormulaC21H21O3P
Molecular Weight352.37 g/mol
Exact Mass352.12
IUPAC Namemethyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate
SMILESCOC(=O)CP(O)(c1ccccc1)(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H21O3P/c1-24-21(22)17-25(23,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23H,17H2,1H3
InChIKeySPTNHCXJEBXECR-UHFFFAOYSA-N
XLogP2.60
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.37
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate?
The IUPAC name of methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate (CID 140553045) is methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate.
What is the SMILES notation for methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate?
The canonical SMILES for methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate is COC(=O)CP(O)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate?
The InChIKey is SPTNHCXJEBXECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O3P/c1-24-21(22)17-25(23,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23H,17H2,1H3.
What are the key properties of methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate?
methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate has a molecular weight of 352.37 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[hydroxy(triphenyl)-λ5-phosphanyl]acetate is sourced from PubChem (CID 140553045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).