C28H34O6SSi — CID 11049688
methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxybutanoate (PubChem CID 11049688) has the molecular formula C28H34O6SSi and a molecular weight of 526.73 g/mol. Its IUPAC name is methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxybutanoate.
| Compound Name | methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxybutanoate |
|---|---|
| PubChem CID | 11049688 |
| Molecular Formula | C28H34O6SSi |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxybutanoate |
| SMILES | COC(=O)C[C@@H](COS(=O)(=O)c1ccc(C)cc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34O6SSi/c1-22-16-18-24(19-17-22)35(30,31)33-21-23(20-27(29)32-5)34-36(28(2,3)4,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-19,23H,20-21H2,1-5H3/t23-/m0/s1 |
| InChIKey | LJSQXIPRUMXAFR-QHCPKHFHSA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|