C21H30O3SSi — CID 161259126
methyl 3-[tert-butyl(diphenyl)silyl]oxybutanoate;sulfane (PubChem CID 161259126) has the molecular formula C21H30O3SSi and a molecular weight of 390.62 g/mol. Its IUPAC name is methyl 3-[tert-butyl(diphenyl)silyl]oxybutanoate;sulfane.
| Compound Name | methyl 3-[tert-butyl(diphenyl)silyl]oxybutanoate;sulfane |
|---|---|
| PubChem CID | 161259126 |
| Molecular Formula | C21H30O3SSi |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 3-[tert-butyl(diphenyl)silyl]oxybutanoate;sulfane |
| SMILES | COC(=O)CC(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.S |
| InChI | InChI=1S/C21H28O3Si.H2S/c1-17(16-20(22)23-5)24-25(21(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17H,16H2,1-5H3;1H2 |
| InChIKey | VCHZPAMVIKSWDL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|