C22H30ClO4PSi — CID 14750058
methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[chloro(methyl)phosphoryl]butanoate (PubChem CID 14750058) has the molecular formula C22H30ClO4PSi and a molecular weight of 452.99 g/mol. Its IUPAC name is methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[chloro(methyl)phosphoryl]butanoate.
| Compound Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[chloro(methyl)phosphoryl]butanoate |
|---|---|
| PubChem CID | 14750058 |
| Molecular Formula | C22H30ClO4PSi |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[chloro(methyl)phosphoryl]butanoate |
| SMILES | COC(=O)CC(CP(C)(=O)Cl)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H30ClO4PSi/c1-22(2,3)29(19-12-8-6-9-13-19,20-14-10-7-11-15-20)27-18(16-21(24)26-4)17-28(5,23)25/h6-15,18H,16-17H2,1-5H3 |
| InChIKey | RAHQNRCGIRXSLW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|