C41H50O5Si2 — CID 14669635
prop-2-enyl (3S,5R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohexanoate (PubChem CID 14669635) has the molecular formula C41H50O5Si2 and a molecular weight of 679.02 g/mol. Its IUPAC name is prop-2-enyl (3S,5R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohexanoate.
| Compound Name | prop-2-enyl (3S,5R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohexanoate |
|---|---|
| PubChem CID | 14669635 |
| Molecular Formula | C41H50O5Si2 |
| Molecular Weight | 679.02 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | prop-2-enyl (3S,5R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohexanoate |
| SMILES | C=CCOC(=O)C[C@H](C[C@H](C=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H50O5Si2/c1-8-29-44-39(43)31-33(45-47(40(2,3)4,35-21-13-9-14-22-35)36-23-15-10-16-24-36)30-34(32-42)46-48(41(5,6)7,37-25-17-11-18-26-37)38-27-19-12-20-28-38/h8-28,32-34H,1,29-31H2,2-7H3/t33-,34+/m0/s1 |
| InChIKey | BLMOJUMBMMRIBU-SZAHLOSFSA-N |
| XLogP | 6.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.02 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|