C22H28O3Si — CID 11079127
prop-2-enyl (2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoate (PubChem CID 11079127) has the molecular formula C22H28O3Si and a molecular weight of 368.55 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoate.
| Compound Name | prop-2-enyl (2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 11079127 |
| Molecular Formula | C22H28O3Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | prop-2-enyl (2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoate |
| SMILES | C=CCOC(=O)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28O3Si/c1-6-17-24-21(23)18(2)25-26(22(3,4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h6-16,18H,1,17H2,2-5H3/t18-/m0/s1 |
| InChIKey | HRJVGDOERSTKOY-SFHVURJKSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|