C38H46O11Si — CID 140818496
benzyl (2R)-2-[(2R)-2-[(2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoate (PubChem CID 140818496) has the molecular formula C38H46O11Si and a molecular weight of 706.86 g/mol. Its IUPAC name is benzyl (2R)-2-[(2R)-2-[(2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoate.
| Compound Name | benzyl (2R)-2-[(2R)-2-[(2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoate |
|---|---|
| PubChem CID | 140818496 |
| Molecular Formula | C38H46O11Si |
| Molecular Weight | 706.86 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | benzyl (2R)-2-[(2R)-2-[(2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoate |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O[C@H](C)C(=O)O[C@H](C)C(=O)O[C@H](C)C(=O)O[C@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H46O11Si/c1-25(33(39)44-24-30-18-12-9-13-19-30)45-34(40)26(2)46-35(41)27(3)47-36(42)28(4)48-37(43)29(5)49-50(38(6,7)8,31-20-14-10-15-21-31)32-22-16-11-17-23-32/h9-23,25-29H,24H2,1-8H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | IEATYSRGMOHLGR-JPHCZMGXSA-N |
| XLogP | 4.42 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|