C45H46O9Si — CID 10509327
dibenzyl (2S)-2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-oxo-4-phenylmethoxybutanoyl]oxybutanedioate (PubChem CID 10509327) has the molecular formula C45H46O9Si and a molecular weight of 758.94 g/mol. Its IUPAC name is dibenzyl (2S)-2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-oxo-4-phenylmethoxybutanoyl]oxybutanedioate.
| Compound Name | dibenzyl (2S)-2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-oxo-4-phenylmethoxybutanoyl]oxybutanedioate |
|---|---|
| PubChem CID | 10509327 |
| Molecular Formula | C45H46O9Si |
| Molecular Weight | 758.94 g/mol |
| Exact Mass | 758.29 |
| IUPAC Name | dibenzyl (2S)-2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-oxo-4-phenylmethoxybutanoyl]oxybutanedioate |
| SMILES | CC(C)(C)[Si](O[C@@H](CC(=O)O[C@@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H46O9Si/c1-45(2,3)55(37-25-15-7-16-26-37,38-27-17-8-18-28-38)54-40(44(49)52-33-36-23-13-6-14-24-36)30-42(47)53-39(43(48)51-32-35-21-11-5-12-22-35)29-41(46)50-31-34-19-9-4-10-20-34/h4-28,39-40H,29-33H2,1-3H3/t39-,40-/m0/s1 |
| InChIKey | KHNJESYCQFABGF-ZAQUEYBZSA-N |
| XLogP | 6.85 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.94 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|