C34H40O9Si — CID 10770177
(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-1,4-dioxo-1-phenylmethoxy-4-propoxybutan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 10770177) has the molecular formula C34H40O9Si and a molecular weight of 620.77 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-1,4-dioxo-1-phenylmethoxy-4-propoxybutan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-1,4-dioxo-1-phenylmethoxy-4-propoxybutan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10770177 |
| Molecular Formula | C34H40O9Si |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-1,4-dioxo-1-phenylmethoxy-4-propoxybutan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | CCCOC(=O)C[C@H](OC(=O)C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H40O9Si/c1-5-21-40-30(35)23-29(33(39)41-24-25-15-9-6-10-16-25)42-31(36)22-28(32(37)38)43-44(34(2,3)4,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,28-29H,5,21-24H2,1-4H3,(H,37,38)/t28-,29-/m0/s1 |
| InChIKey | IUBMCDALHSQGBT-VMPREFPWSA-N |
| XLogP | 4.40 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|