C14H16O7 — CID 143088926
2-[(2S)-2-hydroxypropanoyl]oxy-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 143088926) has the molecular formula C14H16O7 and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxypropanoyl]oxy-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | 2-[(2S)-2-hydroxypropanoyl]oxy-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 143088926 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[(2S)-2-hydroxypropanoyl]oxy-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | C[C@H](O)C(=O)OC(CC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H16O7/c1-9(15)14(19)21-11(13(17)18)7-12(16)20-8-10-5-3-2-4-6-10/h2-6,9,11,15H,7-8H2,1H3,(H,17,18)/t9-,11?/m0/s1 |
| InChIKey | JLKYKGNPMSWBOH-FTNKSUMCSA-N |
| XLogP | 0.50 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |