C29H35NO5Si — CID 66637053
(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 66637053) has the molecular formula C29H35NO5Si and a molecular weight of 505.69 g/mol. Its IUPAC name is (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 66637053 |
| Molecular Formula | C29H35NO5Si |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H35NO5Si/c1-22(26(20-27(31)32)30-28(33)34-21-23-14-8-5-9-15-23)35-36(29(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,26H,20-21H2,1-4H3,(H,30,33)(H,31,32)/t22?,26-/m0/s1 |
| InChIKey | VMKBCMNWEJBUFC-XGCAABAXSA-N |
| XLogP | 4.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|