C30H36N4O4Si — CID 140879359
benzyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate (PubChem CID 140879359) has the molecular formula C30H36N4O4Si and a molecular weight of 544.73 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140879359 |
| Molecular Formula | C30H36N4O4Si |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | benzyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@@H](Cn1nccn1)NC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36N4O4Si/c1-30(2,3)39(25-15-9-5-10-16-25,26-17-11-6-12-18-26)38-23-28(35)27(21-34-31-19-20-32-34)33-29(36)37-22-24-13-7-4-8-14-24/h4-20,27-28,35H,21-23H2,1-3H3,(H,33,36)/t27-,28-/m1/s1 |
| InChIKey | FUADJTXGBBEFQS-VSGBNLITSA-N |
| XLogP | 3.51 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|