C38H43NO6Si — CID 11787017
methyl (E,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)hex-2-enoate (PubChem CID 11787017) has the molecular formula C38H43NO6Si and a molecular weight of 637.85 g/mol. Its IUPAC name is methyl (E,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)hex-2-enoate.
| Compound Name | methyl (E,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)hex-2-enoate |
|---|---|
| PubChem CID | 11787017 |
| Molecular Formula | C38H43NO6Si |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | methyl (E,4S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)hex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](OCc1ccccc1)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H43NO6Si/c1-38(2,3)46(32-21-13-7-14-22-32,33-23-15-8-16-24-33)45-29-34(39-37(41)44-28-31-19-11-6-12-20-31)35(25-26-36(40)42-4)43-27-30-17-9-5-10-18-30/h5-26,34-35H,27-29H2,1-4H3,(H,39,41)/b26-25+/t34-,35-/m0/s1 |
| InChIKey | NHXPEPGJQYIVPU-GSBBDVAKSA-N |
| XLogP | 6.17 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|